C8H9BrN4O4S — CID 106466120
2-[(5-bromo-3-methyltriazol-4-yl)sulfonylamino]pent-4-ynoic acid (PubChem CID 106466120) has the molecular formula C8H9BrN4O4S and a molecular weight of 337.16 g/mol. Its IUPAC name is 2-[(5-bromo-3-methyltriazol-4-yl)sulfonylamino]pent-4-ynoic acid.
| Compound Name | 2-[(5-bromo-3-methyltriazol-4-yl)sulfonylamino]pent-4-ynoic acid |
|---|---|
| PubChem CID | 106466120 |
| Molecular Formula | C8H9BrN4O4S |
| Molecular Weight | 337.16 g/mol |
| Exact Mass | 335.95 |
| IUPAC Name | 2-[(5-bromo-3-methyltriazol-4-yl)sulfonylamino]pent-4-ynoic acid |
| SMILES | C#CCC(NS(=O)(=O)c1c(Br)nnn1C)C(=O)O |
| InChI | InChI=1S/C8H9BrN4O4S/c1-3-4-5(8(14)15)11-18(16,17)7-6(9)10-12-13(7)2/h1,5,11H,4H2,2H3,(H,14,15) |
| InChIKey | DPIPNNNBRVIWFX-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 114.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.16 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|