C9H17BrN4O2S — CID 103354548
5-bromo-N-hexan-3-yl-3-methyltriazole-4-sulfonamide (PubChem CID 103354548) has the molecular formula C9H17BrN4O2S and a molecular weight of 325.23 g/mol. Its IUPAC name is 5-bromo-N-hexan-3-yl-3-methyltriazole-4-sulfonamide.
| Compound Name | 5-bromo-N-hexan-3-yl-3-methyltriazole-4-sulfonamide |
|---|---|
| PubChem CID | 103354548 |
| Molecular Formula | C9H17BrN4O2S |
| Molecular Weight | 325.23 g/mol |
| Exact Mass | 324.03 |
| IUPAC Name | 5-bromo-N-hexan-3-yl-3-methyltriazole-4-sulfonamide |
| SMILES | CCCC(CC)NS(=O)(=O)c1c(Br)nnn1C |
| InChI | InChI=1S/C9H17BrN4O2S/c1-4-6-7(5-2)12-17(15,16)9-8(10)11-13-14(9)3/h7,12H,4-6H2,1-3H3 |
| InChIKey | HYDBSIRFVMKTMY-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.23 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |