C8H11BrN4O6S — CID 106465762
(2S)-2-[(5-bromo-3-methyltriazol-4-yl)sulfonylamino]pentanedioic acid (PubChem CID 106465762) has the molecular formula C8H11BrN4O6S and a molecular weight of 371.17 g/mol. Its IUPAC name is (2S)-2-[(5-bromo-3-methyltriazol-4-yl)sulfonylamino]pentanedioic acid.
| Compound Name | (2S)-2-[(5-bromo-3-methyltriazol-4-yl)sulfonylamino]pentanedioic acid |
|---|---|
| PubChem CID | 106465762 |
| Molecular Formula | C8H11BrN4O6S |
| Molecular Weight | 371.17 g/mol |
| Exact Mass | 369.96 |
| IUPAC Name | (2S)-2-[(5-bromo-3-methyltriazol-4-yl)sulfonylamino]pentanedioic acid |
| SMILES | Cn1nnc(Br)c1S(=O)(=O)N[C@@H](CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C8H11BrN4O6S/c1-13-7(6(9)10-12-13)20(18,19)11-4(8(16)17)2-3-5(14)15/h4,11H,2-3H2,1H3,(H,14,15)(H,16,17)/t4-/m0/s1 |
| InChIKey | LKPPIMZGULLQLC-BYPYZUCNSA-N |
| XLogP | -0.83 |
| TPSA | 151.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.17 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |