C9H13N3O6S — CID 82786695
5-methoxy-5-oxo-2-(1H-pyrazol-4-ylsulfonylamino)pentanoic acid (PubChem CID 82786695) has the molecular formula C9H13N3O6S and a molecular weight of 291.29 g/mol. Its IUPAC name is 5-methoxy-5-oxo-2-(1H-pyrazol-4-ylsulfonylamino)pentanoic acid.
| Compound Name | 5-methoxy-5-oxo-2-(1H-pyrazol-4-ylsulfonylamino)pentanoic acid |
|---|---|
| PubChem CID | 82786695 |
| Molecular Formula | C9H13N3O6S |
| Molecular Weight | 291.29 g/mol |
| Exact Mass | 291.05 |
| IUPAC Name | 5-methoxy-5-oxo-2-(1H-pyrazol-4-ylsulfonylamino)pentanoic acid |
| SMILES | COC(=O)CCC(NS(=O)(=O)c1cn[nH]c1)C(=O)O |
| InChI | InChI=1S/C9H13N3O6S/c1-18-8(13)3-2-7(9(14)15)12-19(16,17)6-4-10-11-5-6/h4-5,7,12H,2-3H2,1H3,(H,10,11)(H,14,15) |
| InChIKey | FCRWAJWSIYZYOY-UHFFFAOYSA-N |
| XLogP | -0.91 |
| TPSA | 138.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.29 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |