C11H14BrN5O3S — CID 106465522
N-[2-(3-aminophenoxy)ethyl]-5-bromo-3-methyltriazole-4-sulfonamide (PubChem CID 106465522) has the molecular formula C11H14BrN5O3S and a molecular weight of 376.24 g/mol. Its IUPAC name is N-[2-(3-aminophenoxy)ethyl]-5-bromo-3-methyltriazole-4-sulfonamide.
| Compound Name | N-[2-(3-aminophenoxy)ethyl]-5-bromo-3-methyltriazole-4-sulfonamide |
|---|---|
| PubChem CID | 106465522 |
| Molecular Formula | C11H14BrN5O3S |
| Molecular Weight | 376.24 g/mol |
| Exact Mass | 375.00 |
| IUPAC Name | N-[2-(3-aminophenoxy)ethyl]-5-bromo-3-methyltriazole-4-sulfonamide |
| SMILES | Cn1nnc(Br)c1S(=O)(=O)NCCOc1cccc(N)c1 |
| InChI | InChI=1S/C11H14BrN5O3S/c1-17-11(10(12)15-16-17)21(18,19)14-5-6-20-9-4-2-3-8(13)7-9/h2-4,7,14H,5-6,13H2,1H3 |
| InChIKey | ANGBMCWIOPYKEA-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 112.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.24 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|