C10H17N3O3S — CID 114804647
3-[2-(ethylsulfamoylamino)ethoxy]aniline (PubChem CID 114804647) has the molecular formula C10H17N3O3S and a molecular weight of 259.33 g/mol. Its IUPAC name is 3-[2-(ethylsulfamoylamino)ethoxy]aniline.
| Compound Name | 3-[2-(ethylsulfamoylamino)ethoxy]aniline |
|---|---|
| PubChem CID | 114804647 |
| Molecular Formula | C10H17N3O3S |
| Molecular Weight | 259.33 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | 3-[2-(ethylsulfamoylamino)ethoxy]aniline |
| SMILES | CCNS(=O)(=O)NCCOc1cccc(N)c1 |
| InChI | InChI=1S/C10H17N3O3S/c1-2-12-17(14,15)13-6-7-16-10-5-3-4-9(11)8-10/h3-5,8,12-13H,2,6-7,11H2,1H3 |
| InChIKey | LFQNTDFMVJNFFA-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.33 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|