C23H29BF3N3O4S — CID 167479196
N-[1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]sulfonylpiperidin-4-yl]-5-(trifluoromethyl)pyridin-2-amine (PubChem CID 167479196) has the molecular formula C23H29BF3N3O4S and a molecular weight of 511.38 g/mol. Its IUPAC name is N-[1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]sulfonylpiperidin-4-yl]-5-(trifluoromethyl)pyridin-2-amine.
| Compound Name | N-[1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]sulfonylpiperidin-4-yl]-5-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 167479196 |
| Molecular Formula | C23H29BF3N3O4S |
| Molecular Weight | 511.38 g/mol |
| Exact Mass | 511.19 |
| IUPAC Name | N-[1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]sulfonylpiperidin-4-yl]-5-(trifluoromethyl)pyridin-2-amine |
| SMILES | CC1(C)OB(c2ccc(S(=O)(=O)N3CCC(Nc4ccc(C(F)(F)F)cn4)CC3)cc2)OC1(C)C |
| InChI | InChI=1S/C23H29BF3N3O4S/c1-21(2)22(3,4)34-24(33-21)17-6-8-19(9-7-17)35(31,32)30-13-11-18(12-14-30)29-20-10-5-16(15-28-20)23(25,26)27/h5-10,15,18H,11-14H2,1-4H3,(H,28,29) |
| InChIKey | SHLRTEPJUKLUSI-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.38 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|