C21H16ClF3N2O2S — CID 89265158
2-chloro-4-[[5-[4-(trifluoromethyl)phenyl]-2,3-dihydroindol-1-yl]sulfonyl]aniline (PubChem CID 89265158) has the molecular formula C21H16ClF3N2O2S and a molecular weight of 452.89 g/mol. Its IUPAC name is 2-chloro-4-[[5-[4-(trifluoromethyl)phenyl]-2,3-dihydroindol-1-yl]sulfonyl]aniline.
| Compound Name | 2-chloro-4-[[5-[4-(trifluoromethyl)phenyl]-2,3-dihydroindol-1-yl]sulfonyl]aniline |
|---|---|
| PubChem CID | 89265158 |
| Molecular Formula | C21H16ClF3N2O2S |
| Molecular Weight | 452.89 g/mol |
| Exact Mass | 452.06 |
| IUPAC Name | 2-chloro-4-[[5-[4-(trifluoromethyl)phenyl]-2,3-dihydroindol-1-yl]sulfonyl]aniline |
| SMILES | Nc1ccc(S(=O)(=O)N2CCc3cc(-c4ccc(C(F)(F)F)cc4)ccc32)cc1Cl |
| InChI | InChI=1S/C21H16ClF3N2O2S/c22-18-12-17(6-7-19(18)26)30(28,29)27-10-9-15-11-14(3-8-20(15)27)13-1-4-16(5-2-13)21(23,24)25/h1-8,11-12H,9-10,26H2 |
| InChIKey | DXPAXZUBRCIWHT-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.89 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|