C23H20F2N2O2S2 — CID 162557939
1-[5-[[5-[4-(1,1-difluoroprop-2-enyl)phenyl]-2,3-dihydroindol-1-yl]sulfonyl]thiophen-2-yl]-N-methylmethanimine (PubChem CID 162557939) has the molecular formula C23H20F2N2O2S2 and a molecular weight of 458.56 g/mol. Its IUPAC name is 1-[5-[[5-[4-(1,1-difluoroprop-2-enyl)phenyl]-2,3-dihydroindol-1-yl]sulfonyl]thiophen-2-yl]-N-methylmethanimine.
| Compound Name | 1-[5-[[5-[4-(1,1-difluoroprop-2-enyl)phenyl]-2,3-dihydroindol-1-yl]sulfonyl]thiophen-2-yl]-N-methylmethanimine |
|---|---|
| PubChem CID | 162557939 |
| Molecular Formula | C23H20F2N2O2S2 |
| Molecular Weight | 458.56 g/mol |
| Exact Mass | 458.09 |
| IUPAC Name | 1-[5-[[5-[4-(1,1-difluoroprop-2-enyl)phenyl]-2,3-dihydroindol-1-yl]sulfonyl]thiophen-2-yl]-N-methylmethanimine |
| SMILES | C=CC(F)(F)c1ccc(-c2ccc3c(c2)CCN3S(=O)(=O)c2ccc(/C=N/C)s2)cc1 |
| InChI | InChI=1S/C23H20F2N2O2S2/c1-3-23(24,25)19-7-4-16(5-8-19)17-6-10-21-18(14-17)12-13-27(21)31(28,29)22-11-9-20(30-22)15-26-2/h3-11,14-15H,1,12-13H2,2H3/b26-15+ |
| InChIKey | WHCXSUANDCZHLY-CVKSISIWSA-N |
| XLogP | 5.49 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.56 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|