C25H22F3N3O3S — CID 174578989
N'-hydroxy-4-[1-[5-[4-(trifluoromethyl)phenyl]-2,3-dihydroindol-1-yl]prop-2-enylsulfonyl]benzenecarboximidamide (PubChem CID 174578989) has the molecular formula C25H22F3N3O3S and a molecular weight of 501.53 g/mol. Its IUPAC name is N'-hydroxy-4-[1-[5-[4-(trifluoromethyl)phenyl]-2,3-dihydroindol-1-yl]prop-2-enylsulfonyl]benzenecarboximidamide.
| Compound Name | N'-hydroxy-4-[1-[5-[4-(trifluoromethyl)phenyl]-2,3-dihydroindol-1-yl]prop-2-enylsulfonyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 174578989 |
| Molecular Formula | C25H22F3N3O3S |
| Molecular Weight | 501.53 g/mol |
| Exact Mass | 501.13 |
| IUPAC Name | N'-hydroxy-4-[1-[5-[4-(trifluoromethyl)phenyl]-2,3-dihydroindol-1-yl]prop-2-enylsulfonyl]benzenecarboximidamide |
| SMILES | C=CC(N1CCc2cc(-c3ccc(C(F)(F)F)cc3)ccc21)S(=O)(=O)c1ccc(C(N)=NO)cc1 |
| InChI | InChI=1S/C25H22F3N3O3S/c1-2-23(35(33,34)21-10-5-17(6-11-21)24(29)30-32)31-14-13-19-15-18(7-12-22(19)31)16-3-8-20(9-4-16)25(26,27)28/h2-12,15,23,32H,1,13-14H2,(H2,29,30) |
| InChIKey | YAEPSZWWSBVFOC-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 95.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.53 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|