C26H24F3N3O4S — CID 76698503
N'-hydroxy-4-[5-[4-(trifluoromethyl)phenyl]spiro[2H-indole-3,4'-oxane]-1-yl]sulfonylbenzenecarboximidamide (PubChem CID 76698503) has the molecular formula C26H24F3N3O4S and a molecular weight of 531.56 g/mol. Its IUPAC name is N'-hydroxy-4-[5-[4-(trifluoromethyl)phenyl]spiro[2H-indole-3,4'-oxane]-1-yl]sulfonylbenzenecarboximidamide.
| Compound Name | N'-hydroxy-4-[5-[4-(trifluoromethyl)phenyl]spiro[2H-indole-3,4'-oxane]-1-yl]sulfonylbenzenecarboximidamide |
|---|---|
| PubChem CID | 76698503 |
| Molecular Formula | C26H24F3N3O4S |
| Molecular Weight | 531.56 g/mol |
| Exact Mass | 531.14 |
| IUPAC Name | N'-hydroxy-4-[5-[4-(trifluoromethyl)phenyl]spiro[2H-indole-3,4'-oxane]-1-yl]sulfonylbenzenecarboximidamide |
| SMILES | NC(=NO)c1ccc(S(=O)(=O)N2CC3(CCOCC3)c3cc(-c4ccc(C(F)(F)F)cc4)ccc32)cc1 |
| InChI | InChI=1S/C26H24F3N3O4S/c27-26(28,29)20-6-1-17(2-7-20)19-5-10-23-22(15-19)25(11-13-36-14-12-25)16-32(23)37(34,35)21-8-3-18(4-9-21)24(30)31-33/h1-10,15,33H,11-14,16H2,(H2,30,31) |
| InChIKey | SKDKQBYEOGFQOB-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 105.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.56 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|