C16H14F3NO2SSe — CID 163360905
1-methylsulfonyl-5-[4-(trifluoromethyl)phenyl]selanyl-2,3-dihydroindole (PubChem CID 163360905) has the molecular formula C16H14F3NO2SSe and a molecular weight of 420.31 g/mol. Its IUPAC name is 1-methylsulfonyl-5-[4-(trifluoromethyl)phenyl]selanyl-2,3-dihydroindole.
| Compound Name | 1-methylsulfonyl-5-[4-(trifluoromethyl)phenyl]selanyl-2,3-dihydroindole |
|---|---|
| PubChem CID | 163360905 |
| Molecular Formula | C16H14F3NO2SSe |
| Molecular Weight | 420.31 g/mol |
| Exact Mass | 420.99 |
| IUPAC Name | 1-methylsulfonyl-5-[4-(trifluoromethyl)phenyl]selanyl-2,3-dihydroindole |
| SMILES | CS(=O)(=O)N1CCc2cc([Se]c3ccc(C(F)(F)F)cc3)ccc21 |
| InChI | InChI=1S/C16H14F3NO2SSe/c1-23(21,22)20-9-8-11-10-14(6-7-15(11)20)24-13-4-2-12(3-5-13)16(17,18)19/h2-7,10H,8-9H2,1H3 |
| InChIKey | KODOBDXRTHKTBY-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.31 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|