C12H18N2O2S — CID 82341039
1-(1-methylsulfonyl-2,3-dihydroindol-5-yl)propan-2-amine (PubChem CID 82341039) has the molecular formula C12H18N2O2S and a molecular weight of 254.36 g/mol. Its IUPAC name is 1-(1-methylsulfonyl-2,3-dihydroindol-5-yl)propan-2-amine.
| Compound Name | 1-(1-methylsulfonyl-2,3-dihydroindol-5-yl)propan-2-amine |
|---|---|
| PubChem CID | 82341039 |
| Molecular Formula | C12H18N2O2S |
| Molecular Weight | 254.36 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | 1-(1-methylsulfonyl-2,3-dihydroindol-5-yl)propan-2-amine |
| SMILES | CC(N)Cc1ccc2c(c1)CCN2S(C)(=O)=O |
| InChI | InChI=1S/C12H18N2O2S/c1-9(13)7-10-3-4-12-11(8-10)5-6-14(12)17(2,15)16/h3-4,8-9H,5-7,13H2,1-2H3 |
| InChIKey | TZEYQCCDWGOHQE-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.36 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |