C12H15N3 — CID 141299224
5-(2-aminopropyl)-2,3-dihydroindole-1-carbonitrile (PubChem CID 141299224) has the molecular formula C12H15N3 and a molecular weight of 201.27 g/mol. Its IUPAC name is 5-(2-aminopropyl)-2,3-dihydroindole-1-carbonitrile.
| Compound Name | 5-(2-aminopropyl)-2,3-dihydroindole-1-carbonitrile |
|---|---|
| PubChem CID | 141299224 |
| Molecular Formula | C12H15N3 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.13 |
| IUPAC Name | 5-(2-aminopropyl)-2,3-dihydroindole-1-carbonitrile |
| SMILES | CC(N)Cc1ccc2c(c1)CCN2C#N |
| InChI | InChI=1S/C12H15N3/c1-9(14)6-10-2-3-12-11(7-10)4-5-15(12)8-13/h2-3,7,9H,4-6,14H2,1H3 |
| InChIKey | SJLYGFDLRAIQOX-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 53.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|