C10H12INO2S — CID 19785606
6-iodo-1-methylsulfonyl-3,4-dihydro-2H-quinoline (PubChem CID 19785606) has the molecular formula C10H12INO2S and a molecular weight of 337.18 g/mol. Its IUPAC name is 6-iodo-1-methylsulfonyl-3,4-dihydro-2H-quinoline.
| Compound Name | 6-iodo-1-methylsulfonyl-3,4-dihydro-2H-quinoline |
|---|---|
| PubChem CID | 19785606 |
| Molecular Formula | C10H12INO2S |
| Molecular Weight | 337.18 g/mol |
| Exact Mass | 336.96 |
| IUPAC Name | 6-iodo-1-methylsulfonyl-3,4-dihydro-2H-quinoline |
| SMILES | CS(=O)(=O)N1CCCc2cc(I)ccc21 |
| InChI | InChI=1S/C10H12INO2S/c1-15(13,14)12-6-2-3-8-7-9(11)4-5-10(8)12/h4-5,7H,2-3,6H2,1H3 |
| InChIKey | BGPYJGZSERBYMB-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.18 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|