C23H16F3N3O4S — CID 58408298
3-[4-[[5-[5-(trifluoromethyl)-2-pyridinyl]-2,3-dihydroindol-1-yl]sulfonyl]phenyl]-4H-1,2-oxazol-5-one (PubChem CID 58408298) has the molecular formula C23H16F3N3O4S and a molecular weight of 487.46 g/mol. Its IUPAC name is 3-[4-[[5-[5-(trifluoromethyl)-2-pyridinyl]-2,3-dihydroindol-1-yl]sulfonyl]phenyl]-4H-1,2-oxazol-5-one.
| Compound Name | 3-[4-[[5-[5-(trifluoromethyl)-2-pyridinyl]-2,3-dihydroindol-1-yl]sulfonyl]phenyl]-4H-1,2-oxazol-5-one |
|---|---|
| PubChem CID | 58408298 |
| Molecular Formula | C23H16F3N3O4S |
| Molecular Weight | 487.46 g/mol |
| Exact Mass | 487.08 |
| IUPAC Name | 3-[4-[[5-[5-(trifluoromethyl)-2-pyridinyl]-2,3-dihydroindol-1-yl]sulfonyl]phenyl]-4H-1,2-oxazol-5-one |
| SMILES | O=C1CC(c2ccc(S(=O)(=O)N3CCc4cc(-c5ccc(C(F)(F)F)cn5)ccc43)cc2)=NO1 |
| InChI | InChI=1S/C23H16F3N3O4S/c24-23(25,26)17-4-7-19(27-13-17)15-3-8-21-16(11-15)9-10-29(21)34(31,32)18-5-1-14(2-6-18)20-12-22(30)33-28-20/h1-8,11,13H,9-10,12H2 |
| InChIKey | WYDMKQOSBHZIJH-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 88.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.46 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'oxime_2', 'substructure': 'N/A'} |
|---|