C19H17N3O3S2 — CID 18109053
4-[[5-(2-methyl-1,3-thiazol-4-yl)-2,3-dihydroindol-1-yl]sulfonyl]benzamide (PubChem CID 18109053) has the molecular formula C19H17N3O3S2 and a molecular weight of 399.50 g/mol. Its IUPAC name is 4-[[5-(2-methyl-1,3-thiazol-4-yl)-2,3-dihydroindol-1-yl]sulfonyl]benzamide.
| Compound Name | 4-[[5-(2-methyl-1,3-thiazol-4-yl)-2,3-dihydroindol-1-yl]sulfonyl]benzamide |
|---|---|
| PubChem CID | 18109053 |
| Molecular Formula | C19H17N3O3S2 |
| Molecular Weight | 399.50 g/mol |
| Exact Mass | 399.07 |
| IUPAC Name | 4-[[5-(2-methyl-1,3-thiazol-4-yl)-2,3-dihydroindol-1-yl]sulfonyl]benzamide |
| SMILES | Cc1nc(-c2ccc3c(c2)CCN3S(=O)(=O)c2ccc(C(N)=O)cc2)cs1 |
| InChI | InChI=1S/C19H17N3O3S2/c1-12-21-17(11-26-12)14-4-7-18-15(10-14)8-9-22(18)27(24,25)16-5-2-13(3-6-16)19(20)23/h2-7,10-11H,8-9H2,1H3,(H2,20,23) |
| InChIKey | HEXUIEBSPSWTDG-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 93.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.50 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |