C29H28F7N3O5S — CID 144804978
acetylene;1,1,1,3,3,3-hexafluoro-2-[1-(4-fluorophenyl)sulfonyl-3,4-dihydro-2H-quinolin-6-yl]propan-2-ol;N-(2-hydroxy-1-pyridin-3-ylethyl)acetamide (PubChem CID 144804978) has the molecular formula C29H28F7N3O5S and a molecular weight of 663.61 g/mol. Its IUPAC name is acetylene;1,1,1,3,3,3-hexafluoro-2-[1-(4-fluorophenyl)sulfonyl-3,4-dihydro-2H-quinolin-6-yl]propan-2-ol;N-(2-hydroxy-1-pyridin-3-ylethyl)acetamide.
| Compound Name | acetylene;1,1,1,3,3,3-hexafluoro-2-[1-(4-fluorophenyl)sulfonyl-3,4-dihydro-2H-quinolin-6-yl]propan-2-ol;N-(2-hydroxy-1-pyridin-3-ylethyl)acetamide |
|---|---|
| PubChem CID | 144804978 |
| Molecular Formula | C29H28F7N3O5S |
| Molecular Weight | 663.61 g/mol |
| Exact Mass | 663.16 |
| IUPAC Name | acetylene;1,1,1,3,3,3-hexafluoro-2-[1-(4-fluorophenyl)sulfonyl-3,4-dihydro-2H-quinolin-6-yl]propan-2-ol;N-(2-hydroxy-1-pyridin-3-ylethyl)acetamide |
| SMILES | C#C.CC(=O)NC(CO)c1cccnc1.O=S(=O)(c1ccc(F)cc1)N1CCCc2cc(C(O)(C(F)(F)F)C(F)(F)F)ccc21 |
| InChI | InChI=1S/C18H14F7NO3S.C9H12N2O2.C2H2/c19-13-4-6-14(7-5-13)30(28,29)26-9-1-2-11-10-12(3-8-15(11)26)16(27,17(20,21)22)18(23,24)25;1-7(13)11-9(6-12)8-3-2-4-10-5-8;1-2/h3-8,10,27H,1-2,9H2;2-5,9,12H,6H2,1H3,(H,11,13);1-2H |
| InChIKey | FLFNJVYAZKDKLY-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 119.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.61 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|