C19H22N2 — CID 63773328
1-(1,2,3,4-tetrahydronaphthalen-1-ylmethyl)-2,3-dihydroindol-6-amine (PubChem CID 63773328) has the molecular formula C19H22N2 and a molecular weight of 278.40 g/mol. Its IUPAC name is 1-(1,2,3,4-tetrahydronaphthalen-1-ylmethyl)-2,3-dihydroindol-6-amine.
| Compound Name | 1-(1,2,3,4-tetrahydronaphthalen-1-ylmethyl)-2,3-dihydroindol-6-amine |
|---|---|
| PubChem CID | 63773328 |
| Molecular Formula | C19H22N2 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.18 |
| IUPAC Name | 1-(1,2,3,4-tetrahydronaphthalen-1-ylmethyl)-2,3-dihydroindol-6-amine |
| SMILES | Nc1ccc2c(c1)N(CC1CCCc3ccccc31)CC2 |
| InChI | InChI=1S/C19H22N2/c20-17-9-8-15-10-11-21(19(15)12-17)13-16-6-3-5-14-4-1-2-7-18(14)16/h1-2,4,7-9,12,16H,3,5-6,10-11,13,20H2 |
| InChIKey | IFVRRUUCUFSNEE-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|