About 2-(7-bicyclo[4.2.0]octa-1,3,5-trienyl)acetonitrile
2-(7-bicyclo[4.2.0]octa-1,3,5-trienyl)acetonitrile (PubChem CID 66419895) has the molecular formula C10H9N
and a molecular weight of 143.19 g/mol. Its IUPAC name is 2-(7-bicyclo[4.2.0]octa-1,3,5-trienyl)acetonitrile.
Analyze 2-(7-bicyclo[4.2.0]octa-1,3,5-trienyl)acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(7-bicyclo[4.2.0]octa-1,3,5-trienyl)acetonitrile?
The IUPAC name of 2-(7-bicyclo[4.2.0]octa-1,3,5-trienyl)acetonitrile (CID 66419895) is 2-(7-bicyclo[4.2.0]octa-1,3,5-trienyl)acetonitrile.
What is the SMILES notation for 2-(7-bicyclo[4.2.0]octa-1,3,5-trienyl)acetonitrile?
The canonical SMILES for 2-(7-bicyclo[4.2.0]octa-1,3,5-trienyl)acetonitrile is N#CCC1Cc2ccccc21.
What is the InChIKey of 2-(7-bicyclo[4.2.0]octa-1,3,5-trienyl)acetonitrile?
The InChIKey is ZBPBTLRUNVTPAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N/c11-6-5-9-7-8-3-1-2-4-10(8)9/h1-4,9H,5,7H2.
What are the key properties of 2-(7-bicyclo[4.2.0]octa-1,3,5-trienyl)acetonitrile?
2-(7-bicyclo[4.2.0]octa-1,3,5-trienyl)acetonitrile has a molecular weight of 143.19 g/mol, XLogP of 2.24, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(7-bicyclo[4.2.0]octa-1,3,5-trienyl)acetonitrile is sourced from PubChem (CID 66419895), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).