C13H14N2O — CID 147490367
N-[2-(cyanomethyl)-2,3-dihydro-1H-inden-1-yl]acetamide (PubChem CID 147490367) has the molecular formula C13H14N2O and a molecular weight of 214.27 g/mol. Its IUPAC name is N-[2-(cyanomethyl)-2,3-dihydro-1H-inden-1-yl]acetamide.
| Compound Name | N-[2-(cyanomethyl)-2,3-dihydro-1H-inden-1-yl]acetamide |
|---|---|
| PubChem CID | 147490367 |
| Molecular Formula | C13H14N2O |
| Molecular Weight | 214.27 g/mol |
| Exact Mass | 214.11 |
| IUPAC Name | N-[2-(cyanomethyl)-2,3-dihydro-1H-inden-1-yl]acetamide |
| SMILES | CC(=O)NC1c2ccccc2CC1CC#N |
| InChI | InChI=1S/C13H14N2O/c1-9(16)15-13-11(6-7-14)8-10-4-2-3-5-12(10)13/h2-5,11,13H,6,8H2,1H3,(H,15,16) |
| InChIKey | FFKCIDBRLOGYEI-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.27 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |