C12H14INO — CID 139750970
N-[(1R,2S)-2-iodo-1,2,3,4-tetrahydronaphthalen-1-yl]acetamide (PubChem CID 139750970) has the molecular formula C12H14INO and a molecular weight of 315.15 g/mol. Its IUPAC name is N-[(1R,2S)-2-iodo-1,2,3,4-tetrahydronaphthalen-1-yl]acetamide.
| Compound Name | N-[(1R,2S)-2-iodo-1,2,3,4-tetrahydronaphthalen-1-yl]acetamide |
|---|---|
| PubChem CID | 139750970 |
| Molecular Formula | C12H14INO |
| Molecular Weight | 315.15 g/mol |
| Exact Mass | 315.01 |
| IUPAC Name | N-[(1R,2S)-2-iodo-1,2,3,4-tetrahydronaphthalen-1-yl]acetamide |
| SMILES | CC(=O)N[C@@H]1c2ccccc2CC[C@@H]1I |
| InChI | InChI=1S/C12H14INO/c1-8(15)14-12-10-5-3-2-4-9(10)6-7-11(12)13/h2-5,11-12H,6-7H2,1H3,(H,14,15)/t11-,12+/m0/s1 |
| InChIKey | TTZPORRRVMWPDY-NWDGAFQWSA-N |
| XLogP | 2.61 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.15 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|