C12H15NO4S — CID 87314664
(1-acetamido-2,3-dihydro-1H-inden-2-yl) methanesulfonate (PubChem CID 87314664) has the molecular formula C12H15NO4S and a molecular weight of 269.32 g/mol. Its IUPAC name is (1-acetamido-2,3-dihydro-1H-inden-2-yl) methanesulfonate.
| Compound Name | (1-acetamido-2,3-dihydro-1H-inden-2-yl) methanesulfonate |
|---|---|
| PubChem CID | 87314664 |
| Molecular Formula | C12H15NO4S |
| Molecular Weight | 269.32 g/mol |
| Exact Mass | 269.07 |
| IUPAC Name | (1-acetamido-2,3-dihydro-1H-inden-2-yl) methanesulfonate |
| SMILES | CC(=O)NC1c2ccccc2CC1OS(C)(=O)=O |
| InChI | InChI=1S/C12H15NO4S/c1-8(14)13-12-10-6-4-3-5-9(10)7-11(12)17-18(2,15)16/h3-6,11-12H,7H2,1-2H3,(H,13,14) |
| InChIKey | WUYIUUBTOZTYKU-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.32 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|