C9H11NO4S — CID 59408283
[(1S,2S)-1-azaniumyl-2,3-dihydro-1H-inden-2-yl] sulfate (PubChem CID 59408283) has the molecular formula C9H11NO4S and a molecular weight of 229.26 g/mol. Its IUPAC name is [(1S,2S)-1-azaniumyl-2,3-dihydro-1H-inden-2-yl] sulfate.
| Compound Name | [(1S,2S)-1-azaniumyl-2,3-dihydro-1H-inden-2-yl] sulfate |
|---|---|
| PubChem CID | 59408283 |
| Molecular Formula | C9H11NO4S |
| Molecular Weight | 229.26 g/mol |
| Exact Mass | 229.04 |
| IUPAC Name | [(1S,2S)-1-azaniumyl-2,3-dihydro-1H-inden-2-yl] sulfate |
| SMILES | [NH3+][C@H]1c2ccccc2C[C@@H]1OS(=O)(=O)[O-] |
| InChI | InChI=1S/C9H11NO4S/c10-9-7-4-2-1-3-6(7)5-8(9)14-15(11,12)13/h1-4,8-9H,5,10H2,(H,11,12,13)/t8-,9-/m0/s1 |
| InChIKey | CVHRBCTWPRIDRU-IUCAKERBSA-N |
| XLogP | -0.63 |
| TPSA | 94.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.26 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|