1-methyl-2,3-dihydro-1H-indene-2-sulfonyl chloride

C10H11ClO2S — CID 164654698

IUPAC1-methyl-2,3-dihydro-1H-indene-2-sulfonyl chloride
SMILESCC1c2ccccc2CC1S(=O)(=O)Cl
InChIInChI=1S/C10H11ClO2S/c1-7-9-5-3-2-4-8(9)6-10(7)14(11,12)13/h2-5,7,10H,6H2,1H3
InChIKeyONWCRZHDDBXQMN-UHFFFAOYSA-N
MW230.72 g/mol
LogP2.28
Rot. Bonds1

About 1-methyl-2,3-dihydro-1H-indene-2-sulfonyl chloride

1-methyl-2,3-dihydro-1H-indene-2-sulfonyl chloride (PubChem CID 164654698) has the molecular formula C10H11ClO2S and a molecular weight of 230.72 g/mol. Its IUPAC name is 1-methyl-2,3-dihydro-1H-indene-2-sulfonyl chloride.

Molecular Properties

Compound Name1-methyl-2,3-dihydro-1H-indene-2-sulfonyl chloride
PubChem CID164654698
Molecular FormulaC10H11ClO2S
Molecular Weight230.72 g/mol
Exact Mass230.02
IUPAC Name1-methyl-2,3-dihydro-1H-indene-2-sulfonyl chloride
SMILESCC1c2ccccc2CC1S(=O)(=O)Cl
InChIInChI=1S/C10H11ClO2S/c1-7-9-5-3-2-4-8(9)6-10(7)14(11,12)13/h2-5,7,10H,6H2,1H3
InChIKeyONWCRZHDDBXQMN-UHFFFAOYSA-N
XLogP2.28
TPSA34.14 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500230.72
LogP ≤ 52.28
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Analyze 1-methyl-2,3-dihydro-1H-indene-2-sulfonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-methyl-2,3-dihydro-1H-indene-2-sulfonyl chloride?
The IUPAC name of 1-methyl-2,3-dihydro-1H-indene-2-sulfonyl chloride (CID 164654698) is 1-methyl-2,3-dihydro-1H-indene-2-sulfonyl chloride.
What is the SMILES notation for 1-methyl-2,3-dihydro-1H-indene-2-sulfonyl chloride?
The canonical SMILES for 1-methyl-2,3-dihydro-1H-indene-2-sulfonyl chloride is CC1c2ccccc2CC1S(=O)(=O)Cl.
What is the InChIKey of 1-methyl-2,3-dihydro-1H-indene-2-sulfonyl chloride?
The InChIKey is ONWCRZHDDBXQMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11ClO2S/c1-7-9-5-3-2-4-8(9)6-10(7)14(11,12)13/h2-5,7,10H,6H2,1H3.
What are the key properties of 1-methyl-2,3-dihydro-1H-indene-2-sulfonyl chloride?
1-methyl-2,3-dihydro-1H-indene-2-sulfonyl chloride has a molecular weight of 230.72 g/mol, XLogP of 2.28, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-2,3-dihydro-1H-indene-2-sulfonyl chloride is sourced from PubChem (CID 164654698), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).