C15H12Cl2O2S — CID 822361
(1R,2S)-1-chloro-2-(4-chlorophenyl)sulfonyl-2,3-dihydro-1H-indene (PubChem CID 822361) has the molecular formula C15H12Cl2O2S and a molecular weight of 327.23 g/mol. Its IUPAC name is (1R,2S)-1-chloro-2-(4-chlorophenyl)sulfonyl-2,3-dihydro-1H-indene.
| Compound Name | (1R,2S)-1-chloro-2-(4-chlorophenyl)sulfonyl-2,3-dihydro-1H-indene |
|---|---|
| PubChem CID | 822361 |
| Molecular Formula | C15H12Cl2O2S |
| Molecular Weight | 327.23 g/mol |
| Exact Mass | 325.99 |
| IUPAC Name | (1R,2S)-1-chloro-2-(4-chlorophenyl)sulfonyl-2,3-dihydro-1H-indene |
| SMILES | O=S(=O)(c1ccc(Cl)cc1)[C@H]1Cc2ccccc2[C@H]1Cl |
| InChI | InChI=1S/C15H12Cl2O2S/c16-11-5-7-12(8-6-11)20(18,19)14-9-10-3-1-2-4-13(10)15(14)17/h1-8,14-15H,9H2/t14-,15+/m0/s1 |
| InChIKey | YCZNBDLLYANJHE-LSDHHAIUSA-N |
| XLogP | 4.02 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.23 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|