C15H13BrClNO2S — CID 114297807
N-(2-bromo-2,3-dihydro-1H-inden-1-yl)-4-chlorobenzenesulfonamide (PubChem CID 114297807) has the molecular formula C15H13BrClNO2S and a molecular weight of 386.70 g/mol. Its IUPAC name is N-(2-bromo-2,3-dihydro-1H-inden-1-yl)-4-chlorobenzenesulfonamide.
| Compound Name | N-(2-bromo-2,3-dihydro-1H-inden-1-yl)-4-chlorobenzenesulfonamide |
|---|---|
| PubChem CID | 114297807 |
| Molecular Formula | C15H13BrClNO2S |
| Molecular Weight | 386.70 g/mol |
| Exact Mass | 384.95 |
| IUPAC Name | N-(2-bromo-2,3-dihydro-1H-inden-1-yl)-4-chlorobenzenesulfonamide |
| SMILES | O=S(=O)(NC1c2ccccc2CC1Br)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H13BrClNO2S/c16-14-9-10-3-1-2-4-13(10)15(14)18-21(19,20)12-7-5-11(17)6-8-12/h1-8,14-15,18H,9H2 |
| InChIKey | AZJIDLLRHMHMPH-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.70 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|