C14H18BrNO3S — CID 114297933
N-(2-bromo-2,3-dihydro-1H-inden-1-yl)-1-(oxolan-2-yl)methanesulfonamide (PubChem CID 114297933) has the molecular formula C14H18BrNO3S and a molecular weight of 360.27 g/mol. Its IUPAC name is N-(2-bromo-2,3-dihydro-1H-inden-1-yl)-1-(oxolan-2-yl)methanesulfonamide.
| Compound Name | N-(2-bromo-2,3-dihydro-1H-inden-1-yl)-1-(oxolan-2-yl)methanesulfonamide |
|---|---|
| PubChem CID | 114297933 |
| Molecular Formula | C14H18BrNO3S |
| Molecular Weight | 360.27 g/mol |
| Exact Mass | 359.02 |
| IUPAC Name | N-(2-bromo-2,3-dihydro-1H-inden-1-yl)-1-(oxolan-2-yl)methanesulfonamide |
| SMILES | O=S(=O)(CC1CCCO1)NC1c2ccccc2CC1Br |
| InChI | InChI=1S/C14H18BrNO3S/c15-13-8-10-4-1-2-6-12(10)14(13)16-20(17,18)9-11-5-3-7-19-11/h1-2,4,6,11,13-14,16H,3,5,7-9H2 |
| InChIKey | BYOKLLFEHRBYSJ-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.27 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|