C15H13FO3S — CID 106585214
2-(2-fluorophenyl)sulfonyl-2,3-dihydro-1H-inden-1-ol (PubChem CID 106585214) has the molecular formula C15H13FO3S and a molecular weight of 292.33 g/mol. Its IUPAC name is 2-(2-fluorophenyl)sulfonyl-2,3-dihydro-1H-inden-1-ol.
| Compound Name | 2-(2-fluorophenyl)sulfonyl-2,3-dihydro-1H-inden-1-ol |
|---|---|
| PubChem CID | 106585214 |
| Molecular Formula | C15H13FO3S |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.06 |
| IUPAC Name | 2-(2-fluorophenyl)sulfonyl-2,3-dihydro-1H-inden-1-ol |
| SMILES | O=S(=O)(c1ccccc1F)C1Cc2ccccc2C1O |
| InChI | InChI=1S/C15H13FO3S/c16-12-7-3-4-8-13(12)20(18,19)14-9-10-5-1-2-6-11(10)15(14)17/h1-8,14-15,17H,9H2 |
| InChIKey | YXXDPVHFJSKOOW-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |