About 2-fluoro-N-[(1R,2S)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]benzenesulfonamide
2-fluoro-N-[(1R,2S)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]benzenesulfonamide (PubChem CID 103825572) has the molecular formula C15H14FNO3S
and a molecular weight of 307.35 g/mol. Its IUPAC name is 2-fluoro-N-[(1R,2S)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]benzenesulfonamide.
Molecular Properties
| Compound Name | 2-fluoro-N-[(1R,2S)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]benzenesulfonamide |
| PubChem CID | 103825572 |
| Molecular Formula | C15H14FNO3S |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.07 |
| IUPAC Name | 2-fluoro-N-[(1R,2S)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]benzenesulfonamide |
| SMILES | O=S(=O)(N[C@@H]1c2ccccc2C[C@@H]1O)c1ccccc1F |
| InChI | InChI=1S/C15H14FNO3S/c16-12-7-3-4-8-14(12)21(19,20)17-15-11-6-2-1-5-10(11)9-13(15)18/h1-8,13,15,17-18H,9H2/t13-,15+/m0/s1 |
| InChIKey | ZMGKUVGNZZBZAR-DZGCQCFKSA-N |
| XLogP | 1.76 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-fluoro-N-[(1R,2S)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-N-[(1R,2S)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]benzenesulfonamide?
The IUPAC name of 2-fluoro-N-[(1R,2S)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]benzenesulfonamide (CID 103825572) is 2-fluoro-N-[(1R,2S)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]benzenesulfonamide.
What is the SMILES notation for 2-fluoro-N-[(1R,2S)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]benzenesulfonamide?
The canonical SMILES for 2-fluoro-N-[(1R,2S)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]benzenesulfonamide is O=S(=O)(N[C@@H]1c2ccccc2C[C@@H]1O)c1ccccc1F.
What is the InChIKey of 2-fluoro-N-[(1R,2S)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]benzenesulfonamide?
The InChIKey is ZMGKUVGNZZBZAR-DZGCQCFKSA-N. The full InChI is InChI=1S/C15H14FNO3S/c16-12-7-3-4-8-14(12)21(19,20)17-15-11-6-2-1-5-10(11)9-13(15)18/h1-8,13,15,17-18H,9H2/t13-,15+/m0/s1.
What are the key properties of 2-fluoro-N-[(1R,2S)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]benzenesulfonamide?
2-fluoro-N-[(1R,2S)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]benzenesulfonamide has a molecular weight of 307.35 g/mol, XLogP of 1.76, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-N-[(1R,2S)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]benzenesulfonamide is sourced from PubChem (CID 103825572), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).