About benzene;2-fluorobenzenesulfonic acid
benzene;2-fluorobenzenesulfonic acid (PubChem CID 174946544) has the molecular formula C12H11FO3S
and a molecular weight of 254.28 g/mol. Its IUPAC name is benzene;2-fluorobenzenesulfonic acid.
Molecular Properties
| Compound Name | benzene;2-fluorobenzenesulfonic acid |
| PubChem CID | 174946544 |
| Molecular Formula | C12H11FO3S |
| Molecular Weight | 254.28 g/mol |
| Exact Mass | 254.04 |
| IUPAC Name | benzene;2-fluorobenzenesulfonic acid |
| SMILES | O=S(=O)(O)c1ccccc1F.c1ccccc1 |
| InChI | InChI=1S/C6H5FO3S.C6H6/c7-5-3-1-2-4-6(5)11(8,9)10;1-2-4-6-5-3-1/h1-4H,(H,8,9,10);1-6H |
| InChIKey | OPWSKPKHZIHBAJ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.28 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze benzene;2-fluorobenzenesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene;2-fluorobenzenesulfonic acid?
The IUPAC name of benzene;2-fluorobenzenesulfonic acid (CID 174946544) is benzene;2-fluorobenzenesulfonic acid.
What is the SMILES notation for benzene;2-fluorobenzenesulfonic acid?
The canonical SMILES for benzene;2-fluorobenzenesulfonic acid is O=S(=O)(O)c1ccccc1F.c1ccccc1.
What is the InChIKey of benzene;2-fluorobenzenesulfonic acid?
The InChIKey is OPWSKPKHZIHBAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5FO3S.C6H6/c7-5-3-1-2-4-6(5)11(8,9)10;1-2-4-6-5-3-1/h1-4H,(H,8,9,10);1-6H.
What are the key properties of benzene;2-fluorobenzenesulfonic acid?
benzene;2-fluorobenzenesulfonic acid has a molecular weight of 254.28 g/mol, XLogP of 2.76, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzene;2-fluorobenzenesulfonic acid is sourced from PubChem (CID 174946544), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).