C14H19NO3S — CID 15611135
(1-pyrrolidin-1-yl-2,3-dihydro-1H-inden-2-yl) methanesulfonate (PubChem CID 15611135) has the molecular formula C14H19NO3S and a molecular weight of 281.38 g/mol. Its IUPAC name is (1-pyrrolidin-1-yl-2,3-dihydro-1H-inden-2-yl) methanesulfonate.
| Compound Name | (1-pyrrolidin-1-yl-2,3-dihydro-1H-inden-2-yl) methanesulfonate |
|---|---|
| PubChem CID | 15611135 |
| Molecular Formula | C14H19NO3S |
| Molecular Weight | 281.38 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | (1-pyrrolidin-1-yl-2,3-dihydro-1H-inden-2-yl) methanesulfonate |
| SMILES | CS(=O)(=O)OC1Cc2ccccc2C1N1CCCC1 |
| InChI | InChI=1S/C14H19NO3S/c1-19(16,17)18-13-10-11-6-2-3-7-12(11)14(13)15-8-4-5-9-15/h2-3,6-7,13-14H,4-5,8-10H2,1H3 |
| InChIKey | LKFKLXPPZNLMPE-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.38 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|