About ethyl 2-(1-acetamido-2,3-dihydro-1H-inden-2-yl)-2-methylpropanoate
ethyl 2-(1-acetamido-2,3-dihydro-1H-inden-2-yl)-2-methylpropanoate (PubChem CID 132579997) has the molecular formula C17H23NO3
and a molecular weight of 289.38 g/mol. Its IUPAC name is ethyl 2-(1-acetamido-2,3-dihydro-1H-inden-2-yl)-2-methylpropanoate.
Molecular Properties
| Compound Name | ethyl 2-(1-acetamido-2,3-dihydro-1H-inden-2-yl)-2-methylpropanoate |
| PubChem CID | 132579997 |
| Molecular Formula | C17H23NO3 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | ethyl 2-(1-acetamido-2,3-dihydro-1H-inden-2-yl)-2-methylpropanoate |
| SMILES | CCOC(=O)C(C)(C)C1Cc2ccccc2C1NC(C)=O |
| InChI | InChI=1S/C17H23NO3/c1-5-21-16(20)17(3,4)14-10-12-8-6-7-9-13(12)15(14)18-11(2)19/h6-9,14-15H,5,10H2,1-4H3,(H,18,19) |
| InChIKey | AHTYPVUMFBDOIM-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl 2-(1-acetamido-2,3-dihydro-1H-inden-2-yl)-2-methylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-(1-acetamido-2,3-dihydro-1H-inden-2-yl)-2-methylpropanoate?
The IUPAC name of ethyl 2-(1-acetamido-2,3-dihydro-1H-inden-2-yl)-2-methylpropanoate (CID 132579997) is ethyl 2-(1-acetamido-2,3-dihydro-1H-inden-2-yl)-2-methylpropanoate.
What is the SMILES notation for ethyl 2-(1-acetamido-2,3-dihydro-1H-inden-2-yl)-2-methylpropanoate?
The canonical SMILES for ethyl 2-(1-acetamido-2,3-dihydro-1H-inden-2-yl)-2-methylpropanoate is CCOC(=O)C(C)(C)C1Cc2ccccc2C1NC(C)=O.
What is the InChIKey of ethyl 2-(1-acetamido-2,3-dihydro-1H-inden-2-yl)-2-methylpropanoate?
The InChIKey is AHTYPVUMFBDOIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23NO3/c1-5-21-16(20)17(3,4)14-10-12-8-6-7-9-13(12)15(14)18-11(2)19/h6-9,14-15H,5,10H2,1-4H3,(H,18,19).
What are the key properties of ethyl 2-(1-acetamido-2,3-dihydro-1H-inden-2-yl)-2-methylpropanoate?
ethyl 2-(1-acetamido-2,3-dihydro-1H-inden-2-yl)-2-methylpropanoate has a molecular weight of 289.38 g/mol, XLogP of 2.63, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-(1-acetamido-2,3-dihydro-1H-inden-2-yl)-2-methylpropanoate is sourced from PubChem (CID 132579997), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).