C19H27NO5 — CID 76594925
diethyl 2-(2-amino-2,3-dihydro-1H-inden-1-yl)-2-(2-methoxyethyl)propanedioate (PubChem CID 76594925) has the molecular formula C19H27NO5 and a molecular weight of 349.43 g/mol. Its IUPAC name is diethyl 2-(2-amino-2,3-dihydro-1H-inden-1-yl)-2-(2-methoxyethyl)propanedioate.
| Compound Name | diethyl 2-(2-amino-2,3-dihydro-1H-inden-1-yl)-2-(2-methoxyethyl)propanedioate |
|---|---|
| PubChem CID | 76594925 |
| Molecular Formula | C19H27NO5 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.19 |
| IUPAC Name | diethyl 2-(2-amino-2,3-dihydro-1H-inden-1-yl)-2-(2-methoxyethyl)propanedioate |
| SMILES | CCOC(=O)C(CCOC)(C(=O)OCC)C1c2ccccc2CC1N |
| InChI | InChI=1S/C19H27NO5/c1-4-24-17(21)19(10-11-23-3,18(22)25-5-2)16-14-9-7-6-8-13(14)12-15(16)20/h6-9,15-16H,4-5,10-12,20H2,1-3H3 |
| InChIKey | WXQGTFPBCXMBRX-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 87.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|