C19H28ClNO5 — CID 68933404
2-[(1S,2R)-2-amino-2,3-dihydro-1H-inden-1-yl]-2-butan-2-yloxycarbonyl-4-methoxybutanoic acid;hydrochloride (PubChem CID 68933404) has the molecular formula C19H28ClNO5 and a molecular weight of 385.89 g/mol. Its IUPAC name is 2-[(1S,2R)-2-amino-2,3-dihydro-1H-inden-1-yl]-2-butan-2-yloxycarbonyl-4-methoxybutanoic acid;hydrochloride.
| Compound Name | 2-[(1S,2R)-2-amino-2,3-dihydro-1H-inden-1-yl]-2-butan-2-yloxycarbonyl-4-methoxybutanoic acid;hydrochloride |
|---|---|
| PubChem CID | 68933404 |
| Molecular Formula | C19H28ClNO5 |
| Molecular Weight | 385.89 g/mol |
| Exact Mass | 385.17 |
| IUPAC Name | 2-[(1S,2R)-2-amino-2,3-dihydro-1H-inden-1-yl]-2-butan-2-yloxycarbonyl-4-methoxybutanoic acid;hydrochloride |
| SMILES | CCC(C)OC(=O)C(CCOC)(C(=O)O)[C@@H]1c2ccccc2C[C@H]1N.Cl |
| InChI | InChI=1S/C19H27NO5.ClH/c1-4-12(2)25-18(23)19(17(21)22,9-10-24-3)16-14-8-6-5-7-13(14)11-15(16)20;/h5-8,12,15-16H,4,9-11,20H2,1-3H3,(H,21,22);1H/t12?,15-,16-,19?;/m1./s1 |
| InChIKey | WQDCODAPYUUGEF-HNGUPKCJSA-N |
| XLogP | 2.52 |
| TPSA | 98.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.89 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|