C28H38O6 — CID 139989393
dibutan-2-yl 2,3-diethyl-2,3-diphenoxybutanedioate (PubChem CID 139989393) has the molecular formula C28H38O6 and a molecular weight of 470.61 g/mol. Its IUPAC name is dibutan-2-yl 2,3-diethyl-2,3-diphenoxybutanedioate.
| Compound Name | dibutan-2-yl 2,3-diethyl-2,3-diphenoxybutanedioate |
|---|---|
| PubChem CID | 139989393 |
| Molecular Formula | C28H38O6 |
| Molecular Weight | 470.61 g/mol |
| Exact Mass | 470.27 |
| IUPAC Name | dibutan-2-yl 2,3-diethyl-2,3-diphenoxybutanedioate |
| SMILES | CCC(C)OC(=O)C(CC)(Oc1ccccc1)C(CC)(Oc1ccccc1)C(=O)OC(C)CC |
| InChI | InChI=1S/C28H38O6/c1-7-21(5)31-25(29)27(9-3,33-23-17-13-11-14-18-23)28(10-4,26(30)32-22(6)8-2)34-24-19-15-12-16-20-24/h11-22H,7-10H2,1-6H3 |
| InChIKey | UFMVFDNYGZXTOX-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.61 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |