C16H17F5O5 — CID 156762066
3-O-benzyl 1-O-butan-2-yl 2-hydroxy-2-(1,1,2,2,2-pentafluoroethyl)propanedioate (PubChem CID 156762066) has the molecular formula C16H17F5O5 and a molecular weight of 384.30 g/mol. Its IUPAC name is 3-O-benzyl 1-O-butan-2-yl 2-hydroxy-2-(1,1,2,2,2-pentafluoroethyl)propanedioate.
| Compound Name | 3-O-benzyl 1-O-butan-2-yl 2-hydroxy-2-(1,1,2,2,2-pentafluoroethyl)propanedioate |
|---|---|
| PubChem CID | 156762066 |
| Molecular Formula | C16H17F5O5 |
| Molecular Weight | 384.30 g/mol |
| Exact Mass | 384.10 |
| IUPAC Name | 3-O-benzyl 1-O-butan-2-yl 2-hydroxy-2-(1,1,2,2,2-pentafluoroethyl)propanedioate |
| SMILES | CCC(C)OC(=O)C(O)(C(=O)OCc1ccccc1)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C16H17F5O5/c1-3-10(2)26-13(23)14(24,15(17,18)16(19,20)21)12(22)25-9-11-7-5-4-6-8-11/h4-8,10,24H,3,9H2,1-2H3 |
| InChIKey | BZWZQITZTBPVCU-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.30 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|