C15H22O3 — CID 172821532
benzyl 2,2-diethyl-3-hydroxybutanoate (PubChem CID 172821532) has the molecular formula C15H22O3 and a molecular weight of 250.34 g/mol. Its IUPAC name is benzyl 2,2-diethyl-3-hydroxybutanoate.
| Compound Name | benzyl 2,2-diethyl-3-hydroxybutanoate |
|---|---|
| PubChem CID | 172821532 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | benzyl 2,2-diethyl-3-hydroxybutanoate |
| SMILES | CCC(CC)(C(=O)OCc1ccccc1)C(C)O |
| InChI | InChI=1S/C15H22O3/c1-4-15(5-2,12(3)16)14(17)18-11-13-9-7-6-8-10-13/h6-10,12,16H,4-5,11H2,1-3H3 |
| InChIKey | UHHMTLJXBKFTQQ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |