C12H8F6O4 — CID 141437036
2,2,3,3,4,4-hexafluoro-5-oxo-5-phenylmethoxypentanoic acid (PubChem CID 141437036) has the molecular formula C12H8F6O4 and a molecular weight of 330.18 g/mol. Its IUPAC name is 2,2,3,3,4,4-hexafluoro-5-oxo-5-phenylmethoxypentanoic acid.
| Compound Name | 2,2,3,3,4,4-hexafluoro-5-oxo-5-phenylmethoxypentanoic acid |
|---|---|
| PubChem CID | 141437036 |
| Molecular Formula | C12H8F6O4 |
| Molecular Weight | 330.18 g/mol |
| Exact Mass | 330.03 |
| IUPAC Name | 2,2,3,3,4,4-hexafluoro-5-oxo-5-phenylmethoxypentanoic acid |
| SMILES | O=C(O)C(F)(F)C(F)(F)C(F)(F)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C12H8F6O4/c13-10(14,8(19)20)12(17,18)11(15,16)9(21)22-6-7-4-2-1-3-5-7/h1-5H,6H2,(H,19,20) |
| InChIKey | ZFKRASNBOJXMSO-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.18 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|