C22H12F12N2O3 — CID 57336557
benzyl 8-(4-cyanoanilino)-2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoro-8-oxooctanoate (PubChem CID 57336557) has the molecular formula C22H12F12N2O3 and a molecular weight of 580.33 g/mol. Its IUPAC name is benzyl 8-(4-cyanoanilino)-2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoro-8-oxooctanoate.
| Compound Name | benzyl 8-(4-cyanoanilino)-2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoro-8-oxooctanoate |
|---|---|
| PubChem CID | 57336557 |
| Molecular Formula | C22H12F12N2O3 |
| Molecular Weight | 580.33 g/mol |
| Exact Mass | 580.07 |
| IUPAC Name | benzyl 8-(4-cyanoanilino)-2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoro-8-oxooctanoate |
| SMILES | N#Cc1ccc(NC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(=O)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C22H12F12N2O3/c23-17(24,15(37)36-14-8-6-12(10-35)7-9-14)19(27,28)21(31,32)22(33,34)20(29,30)18(25,26)16(38)39-11-13-4-2-1-3-5-13/h1-9H,11H2,(H,36,37) |
| InChIKey | WOULLODSKGDPPR-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.33 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|