C15H6F12N2O3 — CID 123417730
8-(4-cyanoanilino)-2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoro-8-oxooctanoic acid (PubChem CID 123417730) has the molecular formula C15H6F12N2O3 and a molecular weight of 490.20 g/mol. Its IUPAC name is 8-(4-cyanoanilino)-2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoro-8-oxooctanoic acid.
| Compound Name | 8-(4-cyanoanilino)-2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoro-8-oxooctanoic acid |
|---|---|
| PubChem CID | 123417730 |
| Molecular Formula | C15H6F12N2O3 |
| Molecular Weight | 490.20 g/mol |
| Exact Mass | 490.02 |
| IUPAC Name | 8-(4-cyanoanilino)-2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoro-8-oxooctanoic acid |
| SMILES | N#Cc1ccc(NC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(=O)O)cc1 |
| InChI | InChI=1S/C15H6F12N2O3/c16-10(17,8(30)29-7-3-1-6(5-28)2-4-7)12(20,21)14(24,25)15(26,27)13(22,23)11(18,19)9(31)32/h1-4H,(H,29,30)(H,31,32) |
| InChIKey | FQBVCDGNLNVVDZ-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 90.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.20 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|