C20H20F2N4O2 — CID 142563453
N-(4-cyanophenyl)-2,2-difluoropropanamide;N-(4-cyanophenyl)formamide;ethane (PubChem CID 142563453) has the molecular formula C20H20F2N4O2 and a molecular weight of 386.40 g/mol. Its IUPAC name is N-(4-cyanophenyl)-2,2-difluoropropanamide;N-(4-cyanophenyl)formamide;ethane.
| Compound Name | N-(4-cyanophenyl)-2,2-difluoropropanamide;N-(4-cyanophenyl)formamide;ethane |
|---|---|
| PubChem CID | 142563453 |
| Molecular Formula | C20H20F2N4O2 |
| Molecular Weight | 386.40 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | N-(4-cyanophenyl)-2,2-difluoropropanamide;N-(4-cyanophenyl)formamide;ethane |
| SMILES | CC.CC(F)(F)C(=O)Nc1ccc(C#N)cc1.N#Cc1ccc(NC=O)cc1 |
| InChI | InChI=1S/C10H8F2N2O.C8H6N2O.C2H6/c1-10(11,12)9(15)14-8-4-2-7(6-13)3-5-8;9-5-7-1-3-8(4-2-7)10-6-11;1-2/h2-5H,1H3,(H,14,15);1-4,6H,(H,10,11);1-2H3 |
| InChIKey | GUBNCNYPTBXVHZ-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 105.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.40 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|