C13H12F5N3O — CID 123852561
1-(4-cyanophenyl)-3-(1,1,1,3,3-pentafluoro-2-methylbutan-2-yl)urea (PubChem CID 123852561) has the molecular formula C13H12F5N3O and a molecular weight of 321.25 g/mol. Its IUPAC name is 1-(4-cyanophenyl)-3-(1,1,1,3,3-pentafluoro-2-methylbutan-2-yl)urea.
| Compound Name | 1-(4-cyanophenyl)-3-(1,1,1,3,3-pentafluoro-2-methylbutan-2-yl)urea |
|---|---|
| PubChem CID | 123852561 |
| Molecular Formula | C13H12F5N3O |
| Molecular Weight | 321.25 g/mol |
| Exact Mass | 321.09 |
| IUPAC Name | 1-(4-cyanophenyl)-3-(1,1,1,3,3-pentafluoro-2-methylbutan-2-yl)urea |
| SMILES | CC(F)(F)C(C)(NC(=O)Nc1ccc(C#N)cc1)C(F)(F)F |
| InChI | InChI=1S/C13H12F5N3O/c1-11(12(2,14)15,13(16,17)18)21-10(22)20-9-5-3-8(7-19)4-6-9/h3-6H,1-2H3,(H2,20,21,22) |
| InChIKey | VCQQRGFFMLMPOC-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.25 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |