C17H24O5 — CID 70556518
2-butan-2-yloxycarbonyl-6-phenoxyhexanoic acid (PubChem CID 70556518) has the molecular formula C17H24O5 and a molecular weight of 308.37 g/mol. Its IUPAC name is 2-butan-2-yloxycarbonyl-6-phenoxyhexanoic acid.
| Compound Name | 2-butan-2-yloxycarbonyl-6-phenoxyhexanoic acid |
|---|---|
| PubChem CID | 70556518 |
| Molecular Formula | C17H24O5 |
| Molecular Weight | 308.37 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | 2-butan-2-yloxycarbonyl-6-phenoxyhexanoic acid |
| SMILES | CCC(C)OC(=O)C(CCCCOc1ccccc1)C(=O)O |
| InChI | InChI=1S/C17H24O5/c1-3-13(2)22-17(20)15(16(18)19)11-7-8-12-21-14-9-5-4-6-10-14/h4-6,9-10,13,15H,3,7-8,11-12H2,1-2H3,(H,18,19) |
| InChIKey | DFSFCMAEGUQLFT-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.37 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|