C16H21FO4 — CID 70551445
2-butan-2-yloxycarbonyl-5-(2-fluorophenyl)pentanoic acid (PubChem CID 70551445) has the molecular formula C16H21FO4 and a molecular weight of 296.34 g/mol. Its IUPAC name is 2-butan-2-yloxycarbonyl-5-(2-fluorophenyl)pentanoic acid.
| Compound Name | 2-butan-2-yloxycarbonyl-5-(2-fluorophenyl)pentanoic acid |
|---|---|
| PubChem CID | 70551445 |
| Molecular Formula | C16H21FO4 |
| Molecular Weight | 296.34 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | 2-butan-2-yloxycarbonyl-5-(2-fluorophenyl)pentanoic acid |
| SMILES | CCC(C)OC(=O)C(CCCc1ccccc1F)C(=O)O |
| InChI | InChI=1S/C16H21FO4/c1-3-11(2)21-16(20)13(15(18)19)9-6-8-12-7-4-5-10-14(12)17/h4-5,7,10-11,13H,3,6,8-9H2,1-2H3,(H,18,19) |
| InChIKey | HXEXJKQVAVQGDH-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.34 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|