C14H17BrO6 — CID 68671812
2-(4-bromophenoxy)-3-butan-2-yloxy-2-(hydroxymethyl)-3-oxopropanoic acid (PubChem CID 68671812) has the molecular formula C14H17BrO6 and a molecular weight of 361.19 g/mol. Its IUPAC name is 2-(4-bromophenoxy)-3-butan-2-yloxy-2-(hydroxymethyl)-3-oxopropanoic acid.
| Compound Name | 2-(4-bromophenoxy)-3-butan-2-yloxy-2-(hydroxymethyl)-3-oxopropanoic acid |
|---|---|
| PubChem CID | 68671812 |
| Molecular Formula | C14H17BrO6 |
| Molecular Weight | 361.19 g/mol |
| Exact Mass | 360.02 |
| IUPAC Name | 2-(4-bromophenoxy)-3-butan-2-yloxy-2-(hydroxymethyl)-3-oxopropanoic acid |
| SMILES | CCC(C)OC(=O)C(CO)(Oc1ccc(Br)cc1)C(=O)O |
| InChI | InChI=1S/C14H17BrO6/c1-3-9(2)20-13(19)14(8-16,12(17)18)21-11-6-4-10(15)5-7-11/h4-7,9,16H,3,8H2,1-2H3,(H,17,18) |
| InChIKey | CMFGFRIRXYPZDF-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.19 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|