C17H25BrO4 — CID 70575274
2-bromo-3-butan-2-yloxy-2-(4-methylphenyl)-3-oxopropanoic acid;propane (PubChem CID 70575274) has the molecular formula C17H25BrO4 and a molecular weight of 373.29 g/mol. Its IUPAC name is 2-bromo-3-butan-2-yloxy-2-(4-methylphenyl)-3-oxopropanoic acid;propane.
| Compound Name | 2-bromo-3-butan-2-yloxy-2-(4-methylphenyl)-3-oxopropanoic acid;propane |
|---|---|
| PubChem CID | 70575274 |
| Molecular Formula | C17H25BrO4 |
| Molecular Weight | 373.29 g/mol |
| Exact Mass | 372.09 |
| IUPAC Name | 2-bromo-3-butan-2-yloxy-2-(4-methylphenyl)-3-oxopropanoic acid;propane |
| SMILES | CCC.CCC(C)OC(=O)C(Br)(C(=O)O)c1ccc(C)cc1 |
| InChI | InChI=1S/C14H17BrO4.C3H8/c1-4-10(3)19-13(18)14(15,12(16)17)11-7-5-9(2)6-8-11;1-3-2/h5-8,10H,4H2,1-3H3,(H,16,17);3H2,1-2H3 |
| InChIKey | VISLMZPIRQZNBY-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.29 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|