C17H22FNO6 — CID 68733798
2-butan-2-yloxycarbonyl-2-(3-fluoro-4-nitrophenyl)-4-methylpentanoic acid (PubChem CID 68733798) has the molecular formula C17H22FNO6 and a molecular weight of 355.36 g/mol. Its IUPAC name is 2-butan-2-yloxycarbonyl-2-(3-fluoro-4-nitrophenyl)-4-methylpentanoic acid.
| Compound Name | 2-butan-2-yloxycarbonyl-2-(3-fluoro-4-nitrophenyl)-4-methylpentanoic acid |
|---|---|
| PubChem CID | 68733798 |
| Molecular Formula | C17H22FNO6 |
| Molecular Weight | 355.36 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | 2-butan-2-yloxycarbonyl-2-(3-fluoro-4-nitrophenyl)-4-methylpentanoic acid |
| SMILES | CCC(C)OC(=O)C(CC(C)C)(C(=O)O)c1ccc([N+](=O)[O-])c(F)c1 |
| InChI | InChI=1S/C17H22FNO6/c1-5-11(4)25-16(22)17(15(20)21,9-10(2)3)12-6-7-14(19(23)24)13(18)8-12/h6-8,10-11H,5,9H2,1-4H3,(H,20,21) |
| InChIKey | KWJOIKSDMUZWDW-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 106.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.36 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|