C13H14F3NO4S — CID 2934544
butan-2-yl 2-[2-nitro-4-(trifluoromethyl)phenyl]sulfanylacetate (PubChem CID 2934544) has the molecular formula C13H14F3NO4S and a molecular weight of 337.32 g/mol. Its IUPAC name is butan-2-yl 2-[2-nitro-4-(trifluoromethyl)phenyl]sulfanylacetate.
| Compound Name | butan-2-yl 2-[2-nitro-4-(trifluoromethyl)phenyl]sulfanylacetate |
|---|---|
| PubChem CID | 2934544 |
| Molecular Formula | C13H14F3NO4S |
| Molecular Weight | 337.32 g/mol |
| Exact Mass | 337.06 |
| IUPAC Name | butan-2-yl 2-[2-nitro-4-(trifluoromethyl)phenyl]sulfanylacetate |
| SMILES | CCC(C)OC(=O)CSc1ccc(C(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H14F3NO4S/c1-3-8(2)21-12(18)7-22-11-5-4-9(13(14,15)16)6-10(11)17(19)20/h4-6,8H,3,7H2,1-2H3 |
| InChIKey | SVLLAXAZDANVTD-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.32 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|