C15H22N2O3 — CID 107222299
2-amino-N-[(1R,2S)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]-5-methoxypentanamide (PubChem CID 107222299) has the molecular formula C15H22N2O3 and a molecular weight of 278.35 g/mol. Its IUPAC name is 2-amino-N-[(1R,2S)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]-5-methoxypentanamide.
| Compound Name | 2-amino-N-[(1R,2S)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]-5-methoxypentanamide |
|---|---|
| PubChem CID | 107222299 |
| Molecular Formula | C15H22N2O3 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | 2-amino-N-[(1R,2S)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]-5-methoxypentanamide |
| SMILES | COCCCC(N)C(=O)N[C@@H]1c2ccccc2C[C@@H]1O |
| InChI | InChI=1S/C15H22N2O3/c1-20-8-4-7-12(16)15(19)17-14-11-6-3-2-5-10(11)9-13(14)18/h2-3,5-6,12-14,18H,4,7-9,16H2,1H3,(H,17,19)/t12?,13-,14+/m0/s1 |
| InChIKey | CDLONGGXLRXMFR-KFTPUPIBSA-N |
| XLogP | 0.51 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|